Export Import Data Solutions provides the latest HS code 85044090 export data and export data of products under 85044090 HS code. 85044090 export Data report helps to find all products exported under the HS code 85044090, exporting price, exporters list, shipment details, etc. The traders can analyze market trends, product demands, products price, etc. and find new customers.
Total Records
| Date | Indian Port | CTH | Item Description | Quantity | UQC | U.P.USD | FOB USD | Destination Port |
|---|---|---|---|---|---|---|---|---|
| 22-Nov-2016 | nhava sheva sea | 85044090 | regulator - ac / dc( meis :-others) | 35 | NOS | 4.89 | 171.15 | cartagena |
| 22-Nov-2016 | bangalore | 85044090 | (p/n:0g-1025) static converter/ups-others-gen assy inv 600 kva nam (meis) | 1 | NOS | 15256.77 | 15256.77 | newark |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#b11097706124700391)(np#125695)(ns#b12569505164701159) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#b11097706124900596)(np#125695)(ns#b12569505164701152) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 111088 assy dcdc charger himagiri (sn#b11108801121200010)(be#5851381 dt:02/07/16) (re-export after repair) | 1 | NOS | 1176.59 | 1176.59 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c11097707131201422)(np#125695)(ns#b12569505164601077) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c11097707131201507)(np#125695)(ns#b12569505164601075) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c1109770a145008977)(np#125695)(ns#b12569505164701146) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c1109770a145008955)(np#125695)(ns#b12569505164701143) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c1109770a145008944)(np#125695)(ns#b12569505164701141) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c1109770a144708741)(np#125695)(ns#b12569505164601076) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | 110977 assy ccpcs 400v dcdc converter nilgiri(os#c1109770a144708781)(np#125695)(ns#b12569505164601080) assy dcdc conver | 1 | NOS | 961.19 | 961.19 | sunnyvale |
| 22-Nov-2016 | bangalore | 85044090 | (p/n:0g-gvmip200kh) static converter/ups-others-galaxy vm 160-200kva 400v ups iocab par (meis) | 1 | NOS | 2897.35 | 2897.35 | rotterdam |
| 22-Nov-2016 | bangalore | 85044090 | (p/n:sypm200kh) static converter/ups-others-apc symmetra mw power section 3 x 66.7kw 400v (meis) | 12 | NOS | 6974.11 | 83689.34 | rotterdam |
| 22-Nov-2016 | kattupalli village ponneri taluk tiruvallur | 85044090 | power bank | 198 | NOS | 0.20 | 39.60 | douala |
| 22-Nov-2016 | banglore air cargo | 85044090 | (p/n:atv71hd18m3xg1in) static converter/spd drives - others - atv71 240v 18,5kw25hp w o emc w graphic g1in (meis) | 3 | NOS | 511.00 | 1533.00 | paris - charles de g |
| 22-Nov-2016 | banglore air cargo | 85044090 | (p/n:atv71hd18m3xg1in) static converter/ spd drives - others - atv71 240v 18,5kw 25hp w o emc w graphic g1in (meis) | 1 | NOS | 511.00 | 511.00 | paris - charles de g |
| 22-Nov-2016 | banglore air cargo | 85044090 | (p/n:beta-gvxi1500kd) galaxy vx 1500kvai/o cabinet (meis) | 2 | NOS | 17716.61 | 35433.22 | los angeles |
| 22-Nov-2016 | banglore air cargo | 85044090 | (p/n:beta-gvxi1500kd)galaxy vx 1500kva i/o cabinet(meis) | 1 | NOS | 17716.61 | 17716.61 | billund |
| 22-Nov-2016 | banglore air cargo | 85044090 | p/no.7074835ps,ac,a254,3phase,12,7kw,b2s/no.465824t+1331c53244 | 1 | NOS | 1178.15 | 1178.15 | bangkok |